C23H34O4 — CID 11516313
(3S,9R,10S,13S,14S)-3-(2-methoxyethoxymethoxy)-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 11516313) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (3S,9R,10S,13S,14S)-3-(2-methoxyethoxymethoxy)-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,9R,10S,13S,14S)-3-(2-methoxyethoxymethoxy)-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11516313 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (3S,9R,10S,13S,14S)-3-(2-methoxyethoxymethoxy)-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | COCCOCO[C@H]1CC[C@]2(C)C(=CC=C3[C@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H34O4/c1-22-10-8-17(27-15-26-13-12-25-3)14-16(22)4-5-18-19-6-7-21(24)23(19,2)11-9-20(18)22/h4-5,17,19-20H,6-15H2,1-3H3/t17-,19-,20+,22+,23-/m0/s1 |
| InChIKey | VJTKBAKEWLKERM-OBFXIHLUSA-N |
| XLogP | 4.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|