C13H16BrNO4 — CID 115163982
3-(5-bromo-2-methoxy-N-methylanilino)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 115163982) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxy-N-methylanilino)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(5-bromo-2-methoxy-N-methylanilino)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 115163982 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 3-(5-bromo-2-methoxy-N-methylanilino)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | COc1ccc(Br)cc1N(C)C(=O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H16BrNO4/c1-13(2,12(17)18)11(16)15(3)9-7-8(14)5-6-10(9)19-4/h5-7H,1-4H3,(H,17,18) |
| InChIKey | JDDWJFWBNDRQTJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|