C20H34O5Si — CID 11516496
[(1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-3-[(Z)-pent-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate (PubChem CID 11516496) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is [(1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-3-[(Z)-pent-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate.
| Compound Name | [(1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-3-[(Z)-pent-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 11516496 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | [(1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-3-[(Z)-pent-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
| SMILES | CCC/C=C\C1=C(CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H34O5Si/c1-8-9-10-11-14-15(12-21)17(25-26(6,7)20(3,4)5)19-18(24-19)16(14)23-13(2)22/h10-11,16-19,21H,8-9,12H2,1-7H3/b11-10-/t16-,17+,18+,19-/m0/s1 |
| InChIKey | KJMUNAVUQAPJGX-WAIXMQTCSA-N |
| XLogP | 3.73 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|