C12H14FNO3 — CID 115165003
4-(4-fluoro-N-methylanilino)-2-methyl-4-oxobutanoic acid (PubChem CID 115165003) has the molecular formula C12H14FNO3 and a molecular weight of 239.25 g/mol. Its IUPAC name is 4-(4-fluoro-N-methylanilino)-2-methyl-4-oxobutanoic acid.
| Compound Name | 4-(4-fluoro-N-methylanilino)-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 115165003 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 4-(4-fluoro-N-methylanilino)-2-methyl-4-oxobutanoic acid |
| SMILES | CC(CC(=O)N(C)c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C12H14FNO3/c1-8(12(16)17)7-11(15)14(2)10-5-3-9(13)4-6-10/h3-6,8H,7H2,1-2H3,(H,16,17) |
| InChIKey | CODYFWNHLGNJOW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |