C16H11F3N2O4S — CID 11516530
2-[2-methyl-1-(2,3,4-trifluorophenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]acetic acid (PubChem CID 11516530) has the molecular formula C16H11F3N2O4S and a molecular weight of 384.34 g/mol. Its IUPAC name is 2-[2-methyl-1-(2,3,4-trifluorophenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]acetic acid.
| Compound Name | 2-[2-methyl-1-(2,3,4-trifluorophenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 11516530 |
| Molecular Formula | C16H11F3N2O4S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-[2-methyl-1-(2,3,4-trifluorophenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cccnc2n1S(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H11F3N2O4S/c1-8-10(7-13(22)23)9-3-2-6-20-16(9)21(8)26(24,25)12-5-4-11(17)14(18)15(12)19/h2-6H,7H2,1H3,(H,22,23) |
| InChIKey | YILPSOCZCPXPKQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|