C23H28O5 — CID 11516541
(1R,2S,3R,4R,6R)-4-[2-[(4-cyclopropylphenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 11516541) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is (1R,2S,3R,4R,6R)-4-[2-[(4-cyclopropylphenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4R,6R)-4-[2-[(4-cyclopropylphenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 11516541 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (1R,2S,3R,4R,6R)-4-[2-[(4-cyclopropylphenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | OC[C@H]1C[C@@H](Oc2ccccc2Cc2ccc(C3CC3)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H28O5/c24-13-18-12-20(22(26)23(27)21(18)25)28-19-4-2-1-3-17(19)11-14-5-7-15(8-6-14)16-9-10-16/h1-8,16,18,20-27H,9-13H2/t18-,20-,21-,22+,23+/m1/s1 |
| InChIKey | XCRLWQNVUFAWND-FXILAVBZSA-N |
| XLogP | 2.00 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |