About 1-(6-bromo-3-pyridinyl)-1,5-diazocane
1-(6-bromo-3-pyridinyl)-1,5-diazocane (PubChem CID 11516571) has the molecular formula C11H16BrN3
and a molecular weight of 270.17 g/mol. Its IUPAC name is 1-(6-bromo-3-pyridinyl)-1,5-diazocane.
Molecular Properties
| Compound Name | 1-(6-bromo-3-pyridinyl)-1,5-diazocane |
| PubChem CID | 11516571 |
| Molecular Formula | C11H16BrN3 |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 1-(6-bromo-3-pyridinyl)-1,5-diazocane |
| SMILES | Brc1ccc(N2CCCNCCC2)cn1 |
| InChI | InChI=1S/C11H16BrN3/c12-11-4-3-10(9-14-11)15-7-1-5-13-6-2-8-15/h3-4,9,13H,1-2,5-8H2 |
| InChIKey | RKHOYJFLFFRBNN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-bromo-3-pyridinyl)-1,5-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-3-pyridinyl)-1,5-diazocane?
The IUPAC name of 1-(6-bromo-3-pyridinyl)-1,5-diazocane (CID 11516571) is 1-(6-bromo-3-pyridinyl)-1,5-diazocane.
What is the SMILES notation for 1-(6-bromo-3-pyridinyl)-1,5-diazocane?
The canonical SMILES for 1-(6-bromo-3-pyridinyl)-1,5-diazocane is Brc1ccc(N2CCCNCCC2)cn1.
What is the InChIKey of 1-(6-bromo-3-pyridinyl)-1,5-diazocane?
The InChIKey is RKHOYJFLFFRBNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrN3/c12-11-4-3-10(9-14-11)15-7-1-5-13-6-2-8-15/h3-4,9,13H,1-2,5-8H2.
What are the key properties of 1-(6-bromo-3-pyridinyl)-1,5-diazocane?
1-(6-bromo-3-pyridinyl)-1,5-diazocane has a molecular weight of 270.17 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-3-pyridinyl)-1,5-diazocane is sourced from PubChem (CID 11516571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).