About [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate
[4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate (PubChem CID 11516603) has the molecular formula C19H17FN2O4S
and a molecular weight of 388.42 g/mol. Its IUPAC name is [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate.
Molecular Properties
| Compound Name | [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate |
| PubChem CID | 11516603 |
| Molecular Formula | C19H17FN2O4S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate |
| SMILES | COc1cc(-c2nc3cc(F)ccc3s2)ccc1OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H17FN2O4S/c1-24-16-10-12(18-21-14-11-13(20)3-5-17(14)27-18)2-4-15(16)26-19(23)22-6-8-25-9-7-22/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | JZRSBAWMPICIJJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate?
The IUPAC name of [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate (CID 11516603) is [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate.
What is the SMILES notation for [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate?
The canonical SMILES for [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate is COc1cc(-c2nc3cc(F)ccc3s2)ccc1OC(=O)N1CCOCC1.
What is the InChIKey of [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate?
The InChIKey is JZRSBAWMPICIJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O4S/c1-24-16-10-12(18-21-14-11-13(20)3-5-17(14)27-18)2-4-15(16)26-19(23)22-6-8-25-9-7-22/h2-5,10-11H,6-9H2,1H3.
What are the key properties of [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate?
[4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate has a molecular weight of 388.42 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methoxyphenyl] morpholine-4-carboxylate is sourced from PubChem (CID 11516603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).