About 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea
1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea (PubChem CID 11516653) has the molecular formula C23H26N4O2
and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea |
| PubChem CID | 11516653 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea |
| SMILES | O=C(Nc1cccc2[nH]ncc12)NC1CCOc2c(C3CCCCC3)cccc21 |
| InChI | InChI=1S/C23H26N4O2/c28-23(25-19-10-5-11-21-18(19)14-24-27-21)26-20-12-13-29-22-16(8-4-9-17(20)22)15-6-2-1-3-7-15/h4-5,8-11,14-15,20H,1-3,6-7,12-13H2,(H,24,27)(H2,25,26,28) |
| InChIKey | NVMRZBHUMZFLEI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea?
The IUPAC name of 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea (CID 11516653) is 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea.
What is the SMILES notation for 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea?
The canonical SMILES for 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea is O=C(Nc1cccc2[nH]ncc12)NC1CCOc2c(C3CCCCC3)cccc21.
What is the InChIKey of 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea?
The InChIKey is NVMRZBHUMZFLEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O2/c28-23(25-19-10-5-11-21-18(19)14-24-27-21)26-20-12-13-29-22-16(8-4-9-17(20)22)15-6-2-1-3-7-15/h4-5,8-11,14-15,20H,1-3,6-7,12-13H2,(H,24,27)(H2,25,26,28).
What are the key properties of 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea?
1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea has a molecular weight of 390.49 g/mol, XLogP of 5.26, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-cyclohexyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea is sourced from PubChem (CID 11516653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).