C8H10N2O2 — CID 115166553
2-oxo-N-[2-(1H-pyrrol-2-yl)ethyl]acetamide (PubChem CID 115166553) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-oxo-N-[2-(1H-pyrrol-2-yl)ethyl]acetamide.
| Compound Name | 2-oxo-N-[2-(1H-pyrrol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 115166553 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-oxo-N-[2-(1H-pyrrol-2-yl)ethyl]acetamide |
| SMILES | O=CC(=O)NCCc1ccc[nH]1 |
| InChI | InChI=1S/C8H10N2O2/c11-6-8(12)10-5-3-7-2-1-4-9-7/h1-2,4,6,9H,3,5H2,(H,10,12) |
| InChIKey | AUJVHRPPXWTGGM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|