C20H25FN2O3S — CID 11516706
N-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 11516706) has the molecular formula C20H25FN2O3S and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 11516706 |
| Molecular Formula | C20H25FN2O3S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNC1CCOc2cc(S(=O)(=O)c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C20H25FN2O3S/c1-23(2)11-4-10-22-19-9-12-26-20-14-17(7-8-18(19)20)27(24,25)16-6-3-5-15(21)13-16/h3,5-8,13-14,19,22H,4,9-12H2,1-2H3 |
| InChIKey | GHVDRLGJJSPFQW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|