C17H14N8O2S — CID 11516748
1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(2-methylthiophen-3-yl)urea (PubChem CID 11516748) has the molecular formula C17H14N8O2S and a molecular weight of 394.42 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(2-methylthiophen-3-yl)urea.
| Compound Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(2-methylthiophen-3-yl)urea |
|---|---|
| PubChem CID | 11516748 |
| Molecular Formula | C17H14N8O2S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(2-methylthiophen-3-yl)urea |
| SMILES | Cc1sccc1NC(=O)Nc1nc2nn(C)cc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C17H14N8O2S/c1-9-11(5-7-28-9)18-17(26)21-16-20-13-10(8-24(2)22-13)15-19-14(23-25(15)16)12-4-3-6-27-12/h3-8H,1-2H3,(H2,18,20,21,22,26) |
| InChIKey | OFJBHNZSLRFALF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |