C21H42O3Si2 — CID 11516854
(2R)-2-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]-3-triethylsilyloxypropanal (PubChem CID 11516854) has the molecular formula C21H42O3Si2 and a molecular weight of 398.74 g/mol. Its IUPAC name is (2R)-2-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]-3-triethylsilyloxypropanal.
| Compound Name | (2R)-2-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]-3-triethylsilyloxypropanal |
|---|---|
| PubChem CID | 11516854 |
| Molecular Formula | C21H42O3Si2 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (2R)-2-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]-3-triethylsilyloxypropanal |
| SMILES | CC[Si](CC)(CC)OC[C@H](C=O)[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H42O3Si2/c1-9-26(10-2,11-3)23-17-19(16-22)18-12-14-20(15-13-18)24-25(7,8)21(4,5)6/h12,14,16,18-20H,9-11,13,15,17H2,1-8H3/t18-,19-,20-/m0/s1 |
| InChIKey | CHLMALABMIPICJ-UFYCRDLUSA-N |
| XLogP | 6.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|