C12H18N2O — CID 115168593
1-[2-(3,4-dimethylphenyl)ethyl]-1-methylurea (PubChem CID 115168593) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenyl)ethyl]-1-methylurea.
| Compound Name | 1-[2-(3,4-dimethylphenyl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 115168593 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-[2-(3,4-dimethylphenyl)ethyl]-1-methylurea |
| SMILES | Cc1ccc(CCN(C)C(N)=O)cc1C |
| InChI | InChI=1S/C12H18N2O/c1-9-4-5-11(8-10(9)2)6-7-14(3)12(13)15/h4-5,8H,6-7H2,1-3H3,(H2,13,15) |
| InChIKey | NVOOAYDBARGXCU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |