C12H14N2O2 — CID 115168716
1-[2-(1-benzofuran-3-yl)ethyl]-1-methylurea (PubChem CID 115168716) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-[2-(1-benzofuran-3-yl)ethyl]-1-methylurea.
| Compound Name | 1-[2-(1-benzofuran-3-yl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 115168716 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-[2-(1-benzofuran-3-yl)ethyl]-1-methylurea |
| SMILES | CN(CCc1coc2ccccc12)C(N)=O |
| InChI | InChI=1S/C12H14N2O2/c1-14(12(13)15)7-6-9-8-16-11-5-3-2-4-10(9)11/h2-5,8H,6-7H2,1H3,(H2,13,15) |
| InChIKey | WMUCWRFALKILSG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |