C13H16N2O2 — CID 115168850
[2-(1-benzofuran-3-yl)-2-methylpropyl]urea (PubChem CID 115168850) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-2-methylpropyl]urea.
| Compound Name | [2-(1-benzofuran-3-yl)-2-methylpropyl]urea |
|---|---|
| PubChem CID | 115168850 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-2-methylpropyl]urea |
| SMILES | CC(C)(CNC(N)=O)c1coc2ccccc12 |
| InChI | InChI=1S/C13H16N2O2/c1-13(2,8-15-12(14)16)10-7-17-11-6-4-3-5-9(10)11/h3-7H,8H2,1-2H3,(H3,14,15,16) |
| InChIKey | NUNIUDCEXXIZCH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |