About N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide
N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide (PubChem CID 11516939) has the molecular formula C15H16F2N4O3S2
and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide |
| PubChem CID | 11516939 |
| Molecular Formula | C15H16F2N4O3S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)N2CCC2)nc(SCc2cccc(F)c2F)n1 |
| InChI | InChI=1S/C15H16F2N4O3S2/c1-24-13-8-12(20-26(22,23)21-6-3-7-21)18-15(19-13)25-9-10-4-2-5-11(16)14(10)17/h2,4-5,8H,3,6-7,9H2,1H3,(H,18,19,20) |
| InChIKey | ZHWNAUARFIHHHI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide?
The IUPAC name of N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide (CID 11516939) is N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide.
What is the SMILES notation for N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide?
The canonical SMILES for N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide is COc1cc(NS(=O)(=O)N2CCC2)nc(SCc2cccc(F)c2F)n1.
What is the InChIKey of N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide?
The InChIKey is ZHWNAUARFIHHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N4O3S2/c1-24-13-8-12(20-26(22,23)21-6-3-7-21)18-15(19-13)25-9-10-4-2-5-11(16)14(10)17/h2,4-5,8H,3,6-7,9H2,1H3,(H,18,19,20).
What are the key properties of N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide?
N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide has a molecular weight of 402.45 g/mol, XLogP of 2.42, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxypyrimidin-4-yl]azetidine-1-sulfonamide is sourced from PubChem (CID 11516939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).