C23H37NO3Si — CID 11516976
tert-butyl N-benzyl-N-[5-[tert-butyl(dimethyl)silyl]oxypent-1-ynyl]carbamate (PubChem CID 11516976) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[5-[tert-butyl(dimethyl)silyl]oxypent-1-ynyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[5-[tert-butyl(dimethyl)silyl]oxypent-1-ynyl]carbamate |
|---|---|
| PubChem CID | 11516976 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | tert-butyl N-benzyl-N-[5-[tert-butyl(dimethyl)silyl]oxypent-1-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C#CCCCO[Si](C)(C)C(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C23H37NO3Si/c1-22(2,3)27-21(25)24(19-20-15-11-9-12-16-20)17-13-10-14-18-26-28(7,8)23(4,5)6/h9,11-12,15-16H,10,14,18-19H2,1-8H3 |
| InChIKey | APEUJVKPYSTVMQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|