C10H10N2O3S — CID 115169878
methyl-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)carbamothioic S-acid (PubChem CID 115169878) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is methyl-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)carbamothioic S-acid.
| Compound Name | methyl-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)carbamothioic S-acid |
|---|---|
| PubChem CID | 115169878 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | methyl-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)carbamothioic S-acid |
| SMILES | CN(C(=O)S)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C10H10N2O3S/c1-11(10(14)16)6-3-4-7-8(5-6)15-9(13)12(7)2/h3-5H,1-2H3,(H,14,16) |
| InChIKey | BCYBSRVHNJKORX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|