C8H11NO2S — CID 115170193
methyl-[(5-methylfuran-2-yl)methyl]carbamothioic S-acid (PubChem CID 115170193) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is methyl-[(5-methylfuran-2-yl)methyl]carbamothioic S-acid.
| Compound Name | methyl-[(5-methylfuran-2-yl)methyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 115170193 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | methyl-[(5-methylfuran-2-yl)methyl]carbamothioic S-acid |
| SMILES | Cc1ccc(CN(C)C(=O)S)o1 |
| InChI | InChI=1S/C8H11NO2S/c1-6-3-4-7(11-6)5-9(2)8(10)12/h3-4H,5H2,1-2H3,(H,10,12) |
| InChIKey | AXELTADMQSGYQY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|