C14H21NOS — CID 115170394
2-(4-butan-2-ylphenyl)ethyl-methylcarbamothioic S-acid (PubChem CID 115170394) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenyl)ethyl-methylcarbamothioic S-acid.
| Compound Name | 2-(4-butan-2-ylphenyl)ethyl-methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 115170394 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(4-butan-2-ylphenyl)ethyl-methylcarbamothioic S-acid |
| SMILES | CCC(C)c1ccc(CCN(C)C(=O)S)cc1 |
| InChI | InChI=1S/C14H21NOS/c1-4-11(2)13-7-5-12(6-8-13)9-10-15(3)14(16)17/h5-8,11H,4,9-10H2,1-3H3,(H,16,17) |
| InChIKey | SKIZOEBXHUNTRV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|