C11H22N2OS — CID 115170602
[2-methyl-2-(1-methylpiperidin-3-yl)propyl]carbamothioic S-acid (PubChem CID 115170602) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is [2-methyl-2-(1-methylpiperidin-3-yl)propyl]carbamothioic S-acid.
| Compound Name | [2-methyl-2-(1-methylpiperidin-3-yl)propyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 115170602 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | [2-methyl-2-(1-methylpiperidin-3-yl)propyl]carbamothioic S-acid |
| SMILES | CN1CCCC(C(C)(C)CNC(=O)S)C1 |
| InChI | InChI=1S/C11H22N2OS/c1-11(2,8-12-10(14)15)9-5-4-6-13(3)7-9/h9H,4-8H2,1-3H3,(H2,12,14,15) |
| InChIKey | KBGZMAKYZMGUDS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|