About methyl-(2,4,5-trimethylphenyl)carbamic acid
methyl-(2,4,5-trimethylphenyl)carbamic acid (PubChem CID 115170749) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is methyl-(2,4,5-trimethylphenyl)carbamic acid.
Molecular Properties
| Compound Name | methyl-(2,4,5-trimethylphenyl)carbamic acid |
| PubChem CID | 115170749 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methyl-(2,4,5-trimethylphenyl)carbamic acid |
| SMILES | Cc1cc(C)c(N(C)C(=O)O)cc1C |
| InChI | InChI=1S/C11H15NO2/c1-7-5-9(3)10(6-8(7)2)12(4)11(13)14/h5-6H,1-4H3,(H,13,14) |
| InChIKey | CKPRMDYARJDIEI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methyl-(2,4,5-trimethylphenyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(2,4,5-trimethylphenyl)carbamic acid?
The IUPAC name of methyl-(2,4,5-trimethylphenyl)carbamic acid (CID 115170749) is methyl-(2,4,5-trimethylphenyl)carbamic acid.
What is the SMILES notation for methyl-(2,4,5-trimethylphenyl)carbamic acid?
The canonical SMILES for methyl-(2,4,5-trimethylphenyl)carbamic acid is Cc1cc(C)c(N(C)C(=O)O)cc1C.
What is the InChIKey of methyl-(2,4,5-trimethylphenyl)carbamic acid?
The InChIKey is CKPRMDYARJDIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-7-5-9(3)10(6-8(7)2)12(4)11(13)14/h5-6H,1-4H3,(H,13,14).
What are the key properties of methyl-(2,4,5-trimethylphenyl)carbamic acid?
methyl-(2,4,5-trimethylphenyl)carbamic acid has a molecular weight of 193.25 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(2,4,5-trimethylphenyl)carbamic acid is sourced from PubChem (CID 115170749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).