C23H23N7O2 — CID 11517572
3-(furo[3,2-d]pyrimidin-4-ylamino)-6,6-dimethyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide (PubChem CID 11517572) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3-(furo[3,2-d]pyrimidin-4-ylamino)-6,6-dimethyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide.
| Compound Name | 3-(furo[3,2-d]pyrimidin-4-ylamino)-6,6-dimethyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 11517572 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 3-(furo[3,2-d]pyrimidin-4-ylamino)-6,6-dimethyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
| SMILES | CC1(C)c2[nH]nc(Nc3ncnc4ccoc34)c2CN1C(=O)N[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H23N7O2/c1-23(2)19-15(20(29-28-19)27-21-18-16(8-9-32-18)24-12-25-21)11-30(23)22(31)26-17-10-14(17)13-6-4-3-5-7-13/h3-9,12,14,17H,10-11H2,1-2H3,(H,26,31)(H2,24,25,27,28,29)/t14-,17+/m1/s1 |
| InChIKey | ASLFQIAAFMLPFR-PBHICJAKSA-N |
| XLogP | 4.01 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |