C27H29ClN2O — CID 11517654
N-[(2-chlorophenyl)methoxy]-1,3,5-trimethyl-2,6-diphenylpiperidin-4-imine (PubChem CID 11517654) has the molecular formula C27H29ClN2O and a molecular weight of 433.00 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methoxy]-1,3,5-trimethyl-2,6-diphenylpiperidin-4-imine.
| Compound Name | N-[(2-chlorophenyl)methoxy]-1,3,5-trimethyl-2,6-diphenylpiperidin-4-imine |
|---|---|
| PubChem CID | 11517654 |
| Molecular Formula | C27H29ClN2O |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[(2-chlorophenyl)methoxy]-1,3,5-trimethyl-2,6-diphenylpiperidin-4-imine |
| SMILES | CC1C(=NOCc2ccccc2Cl)C(C)C(c2ccccc2)N(C)C1c1ccccc1 |
| InChI | InChI=1S/C27H29ClN2O/c1-19-25(29-31-18-23-16-10-11-17-24(23)28)20(2)27(22-14-8-5-9-15-22)30(3)26(19)21-12-6-4-7-13-21/h4-17,19-20,26-27H,18H2,1-3H3 |
| InChIKey | QAMBHBZGODRPGY-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|