C12H17BrN2O3 — CID 115180644
3-amino-N-[(5-bromo-2-methoxyphenyl)methyl]-2-hydroxy-N-methylpropanamide (PubChem CID 115180644) has the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. Its IUPAC name is 3-amino-N-[(5-bromo-2-methoxyphenyl)methyl]-2-hydroxy-N-methylpropanamide.
| Compound Name | 3-amino-N-[(5-bromo-2-methoxyphenyl)methyl]-2-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 115180644 |
| Molecular Formula | C12H17BrN2O3 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 3-amino-N-[(5-bromo-2-methoxyphenyl)methyl]-2-hydroxy-N-methylpropanamide |
| SMILES | COc1ccc(Br)cc1CN(C)C(=O)C(O)CN |
| InChI | InChI=1S/C12H17BrN2O3/c1-15(12(17)10(16)6-14)7-8-5-9(13)3-4-11(8)18-2/h3-5,10,16H,6-7,14H2,1-2H3 |
| InChIKey | CKPQRRMFSNTREB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |