C27H41N3O3 — CID 11518164
ethyl 1-cyclohexyl-3-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-4,5,6,7-tetrahydroindazole-5-carboxylate (PubChem CID 11518164) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is ethyl 1-cyclohexyl-3-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-4,5,6,7-tetrahydroindazole-5-carboxylate.
| Compound Name | ethyl 1-cyclohexyl-3-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-4,5,6,7-tetrahydroindazole-5-carboxylate |
|---|---|
| PubChem CID | 11518164 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | ethyl 1-cyclohexyl-3-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-4,5,6,7-tetrahydroindazole-5-carboxylate |
| SMILES | CCOC(=O)C1CCc2c(c(C(=O)NC3C4(C)CCC(C4)C3(C)C)nn2C2CCCCC2)C1 |
| InChI | InChI=1S/C27H41N3O3/c1-5-33-24(32)17-11-12-21-20(15-17)22(29-30(21)19-9-7-6-8-10-19)23(31)28-25-26(2,3)18-13-14-27(25,4)16-18/h17-19,25H,5-16H2,1-4H3,(H,28,31) |
| InChIKey | HPBBARBTIGEOCN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |