About 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine
1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine (PubChem CID 11518209) has the molecular formula C25H29Cl2N3O
and a molecular weight of 458.43 g/mol. Its IUPAC name is 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine.
Molecular Properties
| Compound Name | 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine |
| PubChem CID | 11518209 |
| Molecular Formula | C25H29Cl2N3O |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine |
| SMILES | Cc1cc(OCCCCN2CCC(c3ccccc3)CC2)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H29Cl2N3O/c1-19-17-25(28-30(19)22-9-10-23(26)24(27)18-22)31-16-6-5-13-29-14-11-21(12-15-29)20-7-3-2-4-8-20/h2-4,7-10,17-18,21H,5-6,11-16H2,1H3 |
| InChIKey | PKBREWIOYKTNBB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine?
The IUPAC name of 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine (CID 11518209) is 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine.
What is the SMILES notation for 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine?
The canonical SMILES for 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine is Cc1cc(OCCCCN2CCC(c3ccccc3)CC2)nn1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine?
The InChIKey is PKBREWIOYKTNBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29Cl2N3O/c1-19-17-25(28-30(19)22-9-10-23(26)24(27)18-22)31-16-6-5-13-29-14-11-21(12-15-29)20-7-3-2-4-8-20/h2-4,7-10,17-18,21H,5-6,11-16H2,1H3.
What are the key properties of 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine?
1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine has a molecular weight of 458.43 g/mol, XLogP of 6.53, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxybutyl]-4-phenylpiperidine is sourced from PubChem (CID 11518209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).