C28H31NO5 — CID 11518279
(3S,4S,7S,8S,10R,13R,14S,21R)-4-ethenyl-21-hydroxy-10-methyl-15,23-dioxa-25-azaheptacyclo[19.2.2.216,19.13,7.01,22.08,13.014,28]octacosa-5,16(27),17,19(26)-tetraene-2,24-dione (PubChem CID 11518279) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is (3S,4S,7S,8S,10R,13R,14S,21R)-4-ethenyl-21-hydroxy-10-methyl-15,23-dioxa-25-azaheptacyclo[19.2.2.216,19.13,7.01,22.08,13.014,28]octacosa-5,16(27),17,19(26)-tetraene-2,24-dione.
| Compound Name | (3S,4S,7S,8S,10R,13R,14S,21R)-4-ethenyl-21-hydroxy-10-methyl-15,23-dioxa-25-azaheptacyclo[19.2.2.216,19.13,7.01,22.08,13.014,28]octacosa-5,16(27),17,19(26)-tetraene-2,24-dione |
|---|---|
| PubChem CID | 11518279 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (3S,4S,7S,8S,10R,13R,14S,21R)-4-ethenyl-21-hydroxy-10-methyl-15,23-dioxa-25-azaheptacyclo[19.2.2.216,19.13,7.01,22.08,13.014,28]octacosa-5,16(27),17,19(26)-tetraene-2,24-dione |
| SMILES | C=C[C@H]1C=CC2C3[C@@H](Oc4ccc(cc4)C[C@]4(O)NC(=O)C5(OC54)C(=O)[C@H]31)[C@@H]1CC[C@@H](C)C[C@@H]21 |
| InChI | InChI=1S/C28H31NO5/c1-3-16-7-11-18-20-12-14(2)4-10-19(20)23-22(18)21(16)24(30)28-25(34-28)27(32,29-26(28)31)13-15-5-8-17(33-23)9-6-15/h3,5-9,11,14,16,18-23,25,32H,1,4,10,12-13H2,2H3,(H,29,31)/t14-,16+,18?,19-,20+,21+,22?,23+,25?,27-,28?/m1/s1 |
| InChIKey | IACNHKNLBOBPTL-MKVQAQTGSA-N |
| XLogP | 2.80 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|