C26H30N4O2S — CID 11518300
3-[5-[3-(2-methoxyethoxy)prop-1-ynyl]thiophen-3-yl]-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole (PubChem CID 11518300) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is 3-[5-[3-(2-methoxyethoxy)prop-1-ynyl]thiophen-3-yl]-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole.
| Compound Name | 3-[5-[3-(2-methoxyethoxy)prop-1-ynyl]thiophen-3-yl]-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole |
|---|---|
| PubChem CID | 11518300 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 3-[5-[3-(2-methoxyethoxy)prop-1-ynyl]thiophen-3-yl]-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole |
| SMILES | COCCOCC#Cc1cc(-c2n[nH]c3c2Cc2cc(CN4CCN(C)CC4)ccc2-3)cs1 |
| InChI | InChI=1S/C26H30N4O2S/c1-29-7-9-30(10-8-29)17-19-5-6-23-20(14-19)16-24-25(27-28-26(23)24)21-15-22(33-18-21)4-3-11-32-13-12-31-2/h5-6,14-15,18H,7-13,16-17H2,1-2H3,(H,27,28) |
| InChIKey | RCYHOLUDUHCVPD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|