C14H15BrN2O2 — CID 115183261
N-(3-bromo-4-methoxyphenyl)-1-cyano-N-methylcyclobutane-1-carboxamide (PubChem CID 115183261) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is N-(3-bromo-4-methoxyphenyl)-1-cyano-N-methylcyclobutane-1-carboxamide.
| Compound Name | N-(3-bromo-4-methoxyphenyl)-1-cyano-N-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 115183261 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-(3-bromo-4-methoxyphenyl)-1-cyano-N-methylcyclobutane-1-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)C2(C#N)CCC2)cc1Br |
| InChI | InChI=1S/C14H15BrN2O2/c1-17(13(18)14(9-16)6-3-7-14)10-4-5-12(19-2)11(15)8-10/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | WFGLDQIDEWADOE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |