C15H17FN2O — CID 115183397
1-cyano-N-[2-(3-fluorophenyl)ethyl]-N-methylcyclobutane-1-carboxamide (PubChem CID 115183397) has the molecular formula C15H17FN2O and a molecular weight of 260.31 g/mol. Its IUPAC name is 1-cyano-N-[2-(3-fluorophenyl)ethyl]-N-methylcyclobutane-1-carboxamide.
| Compound Name | 1-cyano-N-[2-(3-fluorophenyl)ethyl]-N-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 115183397 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-cyano-N-[2-(3-fluorophenyl)ethyl]-N-methylcyclobutane-1-carboxamide |
| SMILES | CN(CCc1cccc(F)c1)C(=O)C1(C#N)CCC1 |
| InChI | InChI=1S/C15H17FN2O/c1-18(14(19)15(11-17)7-3-8-15)9-6-12-4-2-5-13(16)10-12/h2,4-5,10H,3,6-9H2,1H3 |
| InChIKey | VZHFEUWHGLGBQV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |