C16H23NO2 — CID 115183979
1-(hydroxymethyl)-N-methyl-N-(4-propan-2-ylphenyl)cyclobutane-1-carboxamide (PubChem CID 115183979) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-(hydroxymethyl)-N-methyl-N-(4-propan-2-ylphenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(hydroxymethyl)-N-methyl-N-(4-propan-2-ylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 115183979 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-(hydroxymethyl)-N-methyl-N-(4-propan-2-ylphenyl)cyclobutane-1-carboxamide |
| SMILES | CC(C)c1ccc(N(C)C(=O)C2(CO)CCC2)cc1 |
| InChI | InChI=1S/C16H23NO2/c1-12(2)13-5-7-14(8-6-13)17(3)15(19)16(11-18)9-4-10-16/h5-8,12,18H,4,9-11H2,1-3H3 |
| InChIKey | HTWVABWDXCVQTN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |