C29H32N4O2 — CID 11518407
N-[(1R,2S)-2-[(3aR,4R,9bR)-4-(1H-imidazol-2-yl)-2,3,3a,4,5,9b-hexahydrobenzo[g]indole-1-carbonyl]cyclohexyl]benzamide (PubChem CID 11518407) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[(1R,2S)-2-[(3aR,4R,9bR)-4-(1H-imidazol-2-yl)-2,3,3a,4,5,9b-hexahydrobenzo[g]indole-1-carbonyl]cyclohexyl]benzamide.
| Compound Name | N-[(1R,2S)-2-[(3aR,4R,9bR)-4-(1H-imidazol-2-yl)-2,3,3a,4,5,9b-hexahydrobenzo[g]indole-1-carbonyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 11518407 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-[(1R,2S)-2-[(3aR,4R,9bR)-4-(1H-imidazol-2-yl)-2,3,3a,4,5,9b-hexahydrobenzo[g]indole-1-carbonyl]cyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H]1C(=O)N1CC[C@@H]2[C@H](c3ncc[nH]3)Cc3ccccc3[C@@H]21)c1ccccc1 |
| InChI | InChI=1S/C29H32N4O2/c34-28(19-8-2-1-3-9-19)32-25-13-7-6-12-23(25)29(35)33-17-14-22-24(27-30-15-16-31-27)18-20-10-4-5-11-21(20)26(22)33/h1-5,8-11,15-16,22-26H,6-7,12-14,17-18H2,(H,30,31)(H,32,34)/t22-,23+,24-,25-,26+/m1/s1 |
| InChIKey | ATPGUQAMBKYKRK-OAQXCZEZSA-N |
| XLogP | 4.63 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |