C12H14FNO4 — CID 115185186
N-(5-fluoro-2-methoxyphenyl)-3-(hydroxymethyl)oxetane-3-carboxamide (PubChem CID 115185186) has the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. Its IUPAC name is N-(5-fluoro-2-methoxyphenyl)-3-(hydroxymethyl)oxetane-3-carboxamide.
| Compound Name | N-(5-fluoro-2-methoxyphenyl)-3-(hydroxymethyl)oxetane-3-carboxamide |
|---|---|
| PubChem CID | 115185186 |
| Molecular Formula | C12H14FNO4 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(5-fluoro-2-methoxyphenyl)-3-(hydroxymethyl)oxetane-3-carboxamide |
| SMILES | COc1ccc(F)cc1NC(=O)C1(CO)COC1 |
| InChI | InChI=1S/C12H14FNO4/c1-17-10-3-2-8(13)4-9(10)14-11(16)12(5-15)6-18-7-12/h2-4,15H,5-7H2,1H3,(H,14,16) |
| InChIKey | TZIPEKLJHRDYNG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |