C13H15N3O3 — CID 115185226
3-(hydroxymethyl)-N-(2-methyl-3H-benzimidazol-5-yl)oxetane-3-carboxamide (PubChem CID 115185226) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-(hydroxymethyl)-N-(2-methyl-3H-benzimidazol-5-yl)oxetane-3-carboxamide.
| Compound Name | 3-(hydroxymethyl)-N-(2-methyl-3H-benzimidazol-5-yl)oxetane-3-carboxamide |
|---|---|
| PubChem CID | 115185226 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 3-(hydroxymethyl)-N-(2-methyl-3H-benzimidazol-5-yl)oxetane-3-carboxamide |
| SMILES | Cc1nc2ccc(NC(=O)C3(CO)COC3)cc2[nH]1 |
| InChI | InChI=1S/C13H15N3O3/c1-8-14-10-3-2-9(4-11(10)15-8)16-12(18)13(5-17)6-19-7-13/h2-4,17H,5-7H2,1H3,(H,14,15)(H,16,18) |
| InChIKey | IHDVNCVUSLSZLI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |