C12H16N2O3 — CID 115186030
2-[methyl(pyridin-3-ylmethyl)carbamoyl]butanoic acid (PubChem CID 115186030) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[methyl(pyridin-3-ylmethyl)carbamoyl]butanoic acid.
| Compound Name | 2-[methyl(pyridin-3-ylmethyl)carbamoyl]butanoic acid |
|---|---|
| PubChem CID | 115186030 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-[methyl(pyridin-3-ylmethyl)carbamoyl]butanoic acid |
| SMILES | CCC(C(=O)O)C(=O)N(C)Cc1cccnc1 |
| InChI | InChI=1S/C12H16N2O3/c1-3-10(12(16)17)11(15)14(2)8-9-5-4-6-13-7-9/h4-7,10H,3,8H2,1-2H3,(H,16,17) |
| InChIKey | MYEUGTCYCJAZRT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|