C26H24FN7O2 — CID 11518705
6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide (PubChem CID 11518705) has the molecular formula C26H24FN7O2 and a molecular weight of 485.52 g/mol. Its IUPAC name is 6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 11518705 |
| Molecular Formula | C26H24FN7O2 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
| SMILES | Cc1nc(-c2ccc3c(c2)CC[C@@H]3NC(=O)c2cc(C(=O)NCc3ccc(F)c(C)c3)ncn2)n[nH]1 |
| InChI | InChI=1S/C26H24FN7O2/c1-14-9-16(3-7-20(14)27)12-28-25(35)22-11-23(30-13-29-22)26(36)32-21-8-5-17-10-18(4-6-19(17)21)24-31-15(2)33-34-24/h3-4,6-7,9-11,13,21H,5,8,12H2,1-2H3,(H,28,35)(H,32,36)(H,31,33,34)/t21-/m0/s1 |
| InChIKey | SHVFOHZIRWWDMX-NRFANRHFSA-N |
| XLogP | 3.36 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |