C29H33N3O4 — CID 11518761
(1R,3aR)-7-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-N-[(2R)-1-hydroxypropan-2-yl]-1,5,6-trimethyl-3-oxo-1,4,5,6,7,7a-hexahydro-2-benzofuran-3a-carboxamide (PubChem CID 11518761) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is (1R,3aR)-7-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-N-[(2R)-1-hydroxypropan-2-yl]-1,5,6-trimethyl-3-oxo-1,4,5,6,7,7a-hexahydro-2-benzofuran-3a-carboxamide.
| Compound Name | (1R,3aR)-7-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-N-[(2R)-1-hydroxypropan-2-yl]-1,5,6-trimethyl-3-oxo-1,4,5,6,7,7a-hexahydro-2-benzofuran-3a-carboxamide |
|---|---|
| PubChem CID | 11518761 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (1R,3aR)-7-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-N-[(2R)-1-hydroxypropan-2-yl]-1,5,6-trimethyl-3-oxo-1,4,5,6,7,7a-hexahydro-2-benzofuran-3a-carboxamide |
| SMILES | CC1C[C@@]2(C(=O)N[C@H](C)CO)C(=O)OC(C)C2C(/C=C/c2ccc(-c3ccccc3C#N)cn2)C1C |
| InChI | InChI=1S/C29H33N3O4/c1-17-13-29(27(34)32-18(2)16-33)26(20(4)36-28(29)35)24(19(17)3)12-11-23-10-9-22(15-31-23)25-8-6-5-7-21(25)14-30/h5-12,15,17-20,24,26,33H,13,16H2,1-4H3,(H,32,34)/b12-11+/t17?,18-,19?,20?,24?,26?,29-/m1/s1 |
| InChIKey | YOYLYWMIYJGIEQ-RCBRMVHUSA-N |
| XLogP | 3.97 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|