C24H25FN6O5 — CID 11518890
trans-(3R,4R)-N-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-hydroxy-4-[[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]methyl]cyclopentane-1-carboxamide (PubChem CID 11518890) has the molecular formula C24H25FN6O5 and a molecular weight of 496.50 g/mol. Its IUPAC name is trans-(3R,4R)-N-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-hydroxy-4-[[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]methyl]cyclopentane-1-carboxamide.
| Compound Name | trans-(3R,4R)-N-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-hydroxy-4-[[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 11518890 |
| Molecular Formula | C24H25FN6O5 |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | trans-(3R,4R)-N-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-hydroxy-4-[[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]methyl]cyclopentane-1-carboxamide |
| SMILES | COc1ccc2ncc(F)c(NC(=O)C3C[C@H](CNCc4ccc5c(n4)NC(=O)CO5)[C@H](O)C3)c2n1 |
| InChI | InChI=1S/C24H25FN6O5/c1-35-20-5-3-16-22(30-20)21(15(25)10-27-16)31-24(34)12-6-13(17(32)7-12)8-26-9-14-2-4-18-23(28-14)29-19(33)11-36-18/h2-5,10,12-13,17,26,32H,6-9,11H2,1H3,(H,27,31,34)(H,28,29,33)/t12?,13-,17-/m1/s1 |
| InChIKey | SKOFNISUFVBTQV-QQGYXAEISA-N |
| XLogP | 1.62 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |