About N-tert-butyl-2,2,2-trifluoro-N-methylacetamide
N-tert-butyl-2,2,2-trifluoro-N-methylacetamide (PubChem CID 115190151) has the molecular formula C7H12F3NO
and a molecular weight of 183.17 g/mol. Its IUPAC name is N-tert-butyl-2,2,2-trifluoro-N-methylacetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2,2,2-trifluoro-N-methylacetamide |
| PubChem CID | 115190151 |
| Molecular Formula | C7H12F3NO |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | N-tert-butyl-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CN(C(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C7H12F3NO/c1-6(2,3)11(4)5(12)7(8,9)10/h1-4H3 |
| InChIKey | FAHYIYDPAUUIBH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-2,2,2-trifluoro-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2,2-trifluoro-N-methylacetamide?
The IUPAC name of N-tert-butyl-2,2,2-trifluoro-N-methylacetamide (CID 115190151) is N-tert-butyl-2,2,2-trifluoro-N-methylacetamide.
What is the SMILES notation for N-tert-butyl-2,2,2-trifluoro-N-methylacetamide?
The canonical SMILES for N-tert-butyl-2,2,2-trifluoro-N-methylacetamide is CN(C(=O)C(F)(F)F)C(C)(C)C.
What is the InChIKey of N-tert-butyl-2,2,2-trifluoro-N-methylacetamide?
The InChIKey is FAHYIYDPAUUIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO/c1-6(2,3)11(4)5(12)7(8,9)10/h1-4H3.
What are the key properties of N-tert-butyl-2,2,2-trifluoro-N-methylacetamide?
N-tert-butyl-2,2,2-trifluoro-N-methylacetamide has a molecular weight of 183.17 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2,2-trifluoro-N-methylacetamide is sourced from PubChem (CID 115190151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).