C7H7F3N2O — CID 115190190
2,2,2-trifluoro-N-methyl-N-(1H-pyrrol-2-yl)acetamide (PubChem CID 115190190) has the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-(1H-pyrrol-2-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-(1H-pyrrol-2-yl)acetamide |
|---|---|
| PubChem CID | 115190190 |
| Molecular Formula | C7H7F3N2O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-(1H-pyrrol-2-yl)acetamide |
| SMILES | CN(C(=O)C(F)(F)F)c1ccc[nH]1 |
| InChI | InChI=1S/C7H7F3N2O/c1-12(5-3-2-4-11-5)6(13)7(8,9)10/h2-4,11H,1H3 |
| InChIKey | FJWFOBGSGCEVEZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |