C21H36ClN5O5S — CID 11519039
(2S,5S)-N-[(1S,2S)-2-chloro-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[3-(triazol-1-yl)propyl]azepane-2-carboxamide (PubChem CID 11519039) has the molecular formula C21H36ClN5O5S and a molecular weight of 506.07 g/mol. Its IUPAC name is (2S,5S)-N-[(1S,2S)-2-chloro-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[3-(triazol-1-yl)propyl]azepane-2-carboxamide.
| Compound Name | (2S,5S)-N-[(1S,2S)-2-chloro-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[3-(triazol-1-yl)propyl]azepane-2-carboxamide |
|---|---|
| PubChem CID | 11519039 |
| Molecular Formula | C21H36ClN5O5S |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | (2S,5S)-N-[(1S,2S)-2-chloro-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[3-(triazol-1-yl)propyl]azepane-2-carboxamide |
| SMILES | CS[C@H]1OC([C@H](NC(=O)[C@@H]2CC[C@H](CCCn3ccnn3)CCN2)[C@H](C)Cl)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H36ClN5O5S/c1-12(22)15(19-17(29)16(28)18(30)21(32-19)33-2)25-20(31)14-6-5-13(7-8-23-14)4-3-10-27-11-9-24-26-27/h9,11-19,21,23,28-30H,3-8,10H2,1-2H3,(H,25,31)/t12-,13-,14-,15+,16-,17+,18+,19?,21+/m0/s1 |
| InChIKey | VXOYOSLRBZUBET-IZEHLGOMSA-N |
| XLogP | 0.10 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|