C19H22F5N3O6S — CID 11519157
(5S)-5-methyl-5-[[4-[4-(2,2,3,3,3-pentafluoropropoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione (PubChem CID 11519157) has the molecular formula C19H22F5N3O6S and a molecular weight of 515.46 g/mol. Its IUPAC name is (5S)-5-methyl-5-[[4-[4-(2,2,3,3,3-pentafluoropropoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-[[4-[4-(2,2,3,3,3-pentafluoropropoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11519157 |
| Molecular Formula | C19H22F5N3O6S |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | (5S)-5-methyl-5-[[4-[4-(2,2,3,3,3-pentafluoropropoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(CS(=O)(=O)N2CCC(Oc3ccc(OCC(F)(F)C(F)(F)F)cc3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H22F5N3O6S/c1-17(15(28)25-16(29)26-17)11-34(30,31)27-8-6-14(7-9-27)33-13-4-2-12(3-5-13)32-10-18(20,21)19(22,23)24/h2-5,14H,6-11H2,1H3,(H2,25,26,28,29)/t17-/m1/s1 |
| InChIKey | FZWJDQVSTLXMHL-QGZVFWFLSA-N |
| XLogP | 2.03 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|