C12H13N3O2 — CID 115191974
N'-(1H-indol-3-ylmethyl)-N'-methyloxamide (PubChem CID 115191974) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is N'-(1H-indol-3-ylmethyl)-N'-methyloxamide.
| Compound Name | N'-(1H-indol-3-ylmethyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 115191974 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N'-(1H-indol-3-ylmethyl)-N'-methyloxamide |
| SMILES | CN(Cc1c[nH]c2ccccc12)C(=O)C(N)=O |
| InChI | InChI=1S/C12H13N3O2/c1-15(12(17)11(13)16)7-8-6-14-10-5-3-2-4-9(8)10/h2-6,14H,7H2,1H3,(H2,13,16) |
| InChIKey | UQQLBXWYZGXGMN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|