C15H22N2O2 — CID 115192000
N'-[(4-tert-butyl-2-methylphenyl)methyl]-N'-methyloxamide (PubChem CID 115192000) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N'-[(4-tert-butyl-2-methylphenyl)methyl]-N'-methyloxamide.
| Compound Name | N'-[(4-tert-butyl-2-methylphenyl)methyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 115192000 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N'-[(4-tert-butyl-2-methylphenyl)methyl]-N'-methyloxamide |
| SMILES | Cc1cc(C(C)(C)C)ccc1CN(C)C(=O)C(N)=O |
| InChI | InChI=1S/C15H22N2O2/c1-10-8-12(15(2,3)4)7-6-11(10)9-17(5)14(19)13(16)18/h6-8H,9H2,1-5H3,(H2,16,18) |
| InChIKey | VPILZNAZTOCOOL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|