C12H14N4O2 — CID 115192241
N'-[2-(3H-benzimidazol-5-yl)ethyl]-N'-methyloxamide (PubChem CID 115192241) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is N'-[2-(3H-benzimidazol-5-yl)ethyl]-N'-methyloxamide.
| Compound Name | N'-[2-(3H-benzimidazol-5-yl)ethyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 115192241 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | N'-[2-(3H-benzimidazol-5-yl)ethyl]-N'-methyloxamide |
| SMILES | CN(CCc1ccc2nc[nH]c2c1)C(=O)C(N)=O |
| InChI | InChI=1S/C12H14N4O2/c1-16(12(18)11(13)17)5-4-8-2-3-9-10(6-8)15-7-14-9/h2-3,6-7H,4-5H2,1H3,(H2,13,17)(H,14,15) |
| InChIKey | ZVYBXQWBWQIUAZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|