C12H17N5O — CID 115193077
3-amino-1-methyl-1-[2-(1-methylbenzimidazol-5-yl)ethyl]urea (PubChem CID 115193077) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-amino-1-methyl-1-[2-(1-methylbenzimidazol-5-yl)ethyl]urea.
| Compound Name | 3-amino-1-methyl-1-[2-(1-methylbenzimidazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 115193077 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-amino-1-methyl-1-[2-(1-methylbenzimidazol-5-yl)ethyl]urea |
| SMILES | CN(CCc1ccc2c(c1)ncn2C)C(=O)NN |
| InChI | InChI=1S/C12H17N5O/c1-16(12(18)15-13)6-5-9-3-4-11-10(7-9)14-8-17(11)2/h3-4,7-8H,5-6,13H2,1-2H3,(H,15,18) |
| InChIKey | ZOGIPUDDYMIBCW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|