C25H29F3N6O4 — CID 11519429
(2S)-3-[4-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]phenyl]-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]propanoic acid (PubChem CID 11519429) has the molecular formula C25H29F3N6O4 and a molecular weight of 534.54 g/mol. Its IUPAC name is (2S)-3-[4-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]phenyl]-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]phenyl]-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 11519429 |
| Molecular Formula | C25H29F3N6O4 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | (2S)-3-[4-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]phenyl]-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]propanoic acid |
| SMILES | CCN(CC)c1ncc(CC(F)(F)F)c(N[C@@H](Cc2ccc(N3C(=O)[C@@H]4CCCN4C3=O)cc2)C(=O)O)n1 |
| InChI | InChI=1S/C25H29F3N6O4/c1-3-32(4-2)23-29-14-16(13-25(26,27)28)20(31-23)30-18(22(36)37)12-15-7-9-17(10-8-15)34-21(35)19-6-5-11-33(19)24(34)38/h7-10,14,18-19H,3-6,11-13H2,1-2H3,(H,36,37)(H,29,30,31)/t18-,19-/m0/s1 |
| InChIKey | GNEZLXVDJRNKGA-OALUTQOASA-N |
| XLogP | 3.47 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|