C11H18N2O2S — CID 115195453
N'-[2-(4-methylsulfonylphenyl)ethyl]ethane-1,2-diamine (PubChem CID 115195453) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is N'-[2-(4-methylsulfonylphenyl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(4-methylsulfonylphenyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 115195453 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N'-[2-(4-methylsulfonylphenyl)ethyl]ethane-1,2-diamine |
| SMILES | CS(=O)(=O)c1ccc(CCNCCN)cc1 |
| InChI | InChI=1S/C11H18N2O2S/c1-16(14,15)11-4-2-10(3-5-11)6-8-13-9-7-12/h2-5,13H,6-9,12H2,1H3 |
| InChIKey | PKXNDQGHVBWYOM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|